C8H17N3O4 — CID 88517039
[2-(4-aminobutanoylamino)-2-methylpropyl] nitrate (PubChem CID 88517039) has the molecular formula C8H17N3O4 and a molecular weight of 219.24 g/mol. Its IUPAC name is [2-(4-aminobutanoylamino)-2-methylpropyl] nitrate.
| Compound Name | [2-(4-aminobutanoylamino)-2-methylpropyl] nitrate |
|---|---|
| PubChem CID | 88517039 |
| Molecular Formula | C8H17N3O4 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | [2-(4-aminobutanoylamino)-2-methylpropyl] nitrate |
| SMILES | CC(C)(CO[N+](=O)[O-])NC(=O)CCCN |
| InChI | InChI=1S/C8H17N3O4/c1-8(2,6-15-11(13)14)10-7(12)4-3-5-9/h3-6,9H2,1-2H3,(H,10,12) |
| InChIKey | CLYALVUEEIPVOX-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|