C11H19N3O8 — CID 173374085
[3-(2-aminoethylamino)-2,2-dimethyl-3-oxopropyl] nitrate;but-2-enedioic acid (PubChem CID 173374085) has the molecular formula C11H19N3O8 and a molecular weight of 321.29 g/mol. Its IUPAC name is [3-(2-aminoethylamino)-2,2-dimethyl-3-oxopropyl] nitrate;but-2-enedioic acid.
| Compound Name | [3-(2-aminoethylamino)-2,2-dimethyl-3-oxopropyl] nitrate;but-2-enedioic acid |
|---|---|
| PubChem CID | 173374085 |
| Molecular Formula | C11H19N3O8 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | [3-(2-aminoethylamino)-2,2-dimethyl-3-oxopropyl] nitrate;but-2-enedioic acid |
| SMILES | CC(C)(CO[N+](=O)[O-])C(=O)NCCN.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C7H15N3O4.C4H4O4/c1-7(2,5-14-10(12)13)6(11)9-4-3-8;5-3(6)1-2-4(7)8/h3-5,8H2,1-2H3,(H,9,11);1-2H,(H,5,6)(H,7,8) |
| InChIKey | YFJKYGSZGZPHTN-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 182.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|