C16H30N4O6 — CID 57214184
bis[3-(2-aminoethylamino)-2,2-dimethyl-3-oxopropyl] oxalate (PubChem CID 57214184) has the molecular formula C16H30N4O6 and a molecular weight of 374.44 g/mol. Its IUPAC name is bis[3-(2-aminoethylamino)-2,2-dimethyl-3-oxopropyl] oxalate.
| Compound Name | bis[3-(2-aminoethylamino)-2,2-dimethyl-3-oxopropyl] oxalate |
|---|---|
| PubChem CID | 57214184 |
| Molecular Formula | C16H30N4O6 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | bis[3-(2-aminoethylamino)-2,2-dimethyl-3-oxopropyl] oxalate |
| SMILES | CC(C)(COC(=O)C(=O)OCC(C)(C)C(=O)NCCN)C(=O)NCCN |
| InChI | InChI=1S/C16H30N4O6/c1-15(2,13(23)19-7-5-17)9-25-11(21)12(22)26-10-16(3,4)14(24)20-8-6-18/h5-10,17-18H2,1-4H3,(H,19,23)(H,20,24) |
| InChIKey | WIGZDNLOBXVOJI-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|