C11H24N6O3 — CID 15388023
1-N,1-N,1-N-tris(2-aminoethyl)ethane-1,1,1-tricarboxamide (PubChem CID 15388023) has the molecular formula C11H24N6O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-N,1-N,1-N-tris(2-aminoethyl)ethane-1,1,1-tricarboxamide.
| Compound Name | 1-N,1-N,1-N-tris(2-aminoethyl)ethane-1,1,1-tricarboxamide |
|---|---|
| PubChem CID | 15388023 |
| Molecular Formula | C11H24N6O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 1-N,1-N,1-N-tris(2-aminoethyl)ethane-1,1,1-tricarboxamide |
| SMILES | CC(C(=O)NCCN)(C(=O)NCCN)C(=O)NCCN |
| InChI | InChI=1S/C11H24N6O3/c1-11(8(18)15-5-2-12,9(19)16-6-3-13)10(20)17-7-4-14/h2-7,12-14H2,1H3,(H,15,18)(H,16,19)(H,17,20) |
| InChIKey | MARBGILSPHPCRW-UHFFFAOYSA-N |
| XLogP | -3.78 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|