C14H31FN2O — CID 175966813
N-(2-aminoethyl)-2,2-diethyloctanamide;hydrofluoride (PubChem CID 175966813) has the molecular formula C14H31FN2O and a molecular weight of 262.41 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,2-diethyloctanamide;hydrofluoride.
| Compound Name | N-(2-aminoethyl)-2,2-diethyloctanamide;hydrofluoride |
|---|---|
| PubChem CID | 175966813 |
| Molecular Formula | C14H31FN2O |
| Molecular Weight | 262.41 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | N-(2-aminoethyl)-2,2-diethyloctanamide;hydrofluoride |
| SMILES | CCCCCCC(CC)(CC)C(=O)NCCN.F |
| InChI | InChI=1S/C14H30N2O.FH/c1-4-7-8-9-10-14(5-2,6-3)13(17)16-12-11-15;/h4-12,15H2,1-3H3,(H,16,17);1H |
| InChIKey | MUNUJUYFIUECNW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|