C13H21N3O8 — CID 67929917
[4-(2-aminoethylcarbamoyl)cyclohexyl] nitrate;but-2-enedioic acid (PubChem CID 67929917) has the molecular formula C13H21N3O8 and a molecular weight of 347.32 g/mol. Its IUPAC name is [4-(2-aminoethylcarbamoyl)cyclohexyl] nitrate;but-2-enedioic acid.
| Compound Name | [4-(2-aminoethylcarbamoyl)cyclohexyl] nitrate;but-2-enedioic acid |
|---|---|
| PubChem CID | 67929917 |
| Molecular Formula | C13H21N3O8 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [4-(2-aminoethylcarbamoyl)cyclohexyl] nitrate;but-2-enedioic acid |
| SMILES | NCCNC(=O)C1CCC(O[N+](=O)[O-])CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C9H17N3O4.C4H4O4/c10-5-6-11-9(13)7-1-3-8(4-2-7)16-12(14)15;5-3(6)1-2-4(7)8/h7-8H,1-6,10H2,(H,11,13);1-2H,(H,5,6)(H,7,8) |
| InChIKey | LXKXIYCHYLPHSX-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 182.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|