C3H5N7O8 — CID 12938666
1-nitro-2-(2,2,2-trinitroethyl)guanidine (PubChem CID 12938666) has the molecular formula C3H5N7O8 and a molecular weight of 267.11 g/mol. Its IUPAC name is 1-nitro-2-(2,2,2-trinitroethyl)guanidine.
| Compound Name | 1-nitro-2-(2,2,2-trinitroethyl)guanidine |
|---|---|
| PubChem CID | 12938666 |
| Molecular Formula | C3H5N7O8 |
| Molecular Weight | 267.11 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 1-nitro-2-(2,2,2-trinitroethyl)guanidine |
| SMILES | N/C(=N\CC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])N[N+](=O)[O-] |
| InChI | InChI=1S/C3H5N7O8/c4-2(6-10(17)18)5-1-3(7(11)12,8(13)14)9(15)16/h1H2,(H3,4,5,6) |
| InChIKey | JLIGJQHIAFFVIF-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 222.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.11 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|