C7H14N4O2 — CID 73189286
2-(3-methylpent-2-enyl)-1-nitroguanidine (PubChem CID 73189286) has the molecular formula C7H14N4O2 and a molecular weight of 186.22 g/mol. Its IUPAC name is 2-(3-methylpent-2-enyl)-1-nitroguanidine.
| Compound Name | 2-(3-methylpent-2-enyl)-1-nitroguanidine |
|---|---|
| PubChem CID | 73189286 |
| Molecular Formula | C7H14N4O2 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 2-(3-methylpent-2-enyl)-1-nitroguanidine |
| SMILES | CCC(C)=CC/N=C(\N)N[N+](=O)[O-] |
| InChI | InChI=1S/C7H14N4O2/c1-3-6(2)4-5-9-7(8)10-11(12)13/h4H,3,5H2,1-2H3,(H3,8,9,10) |
| InChIKey | LALCKZCXSBDMGA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|