C14H30F3N7O8 — CID 24986807
2-[(4S)-4-amino-5-(2-aminoethylamino)pentyl]-1-nitroguanidine;fluoro acetate (PubChem CID 24986807) has the molecular formula C14H30F3N7O8 and a molecular weight of 481.43 g/mol. Its IUPAC name is 2-[(4S)-4-amino-5-(2-aminoethylamino)pentyl]-1-nitroguanidine;fluoro acetate.
| Compound Name | 2-[(4S)-4-amino-5-(2-aminoethylamino)pentyl]-1-nitroguanidine;fluoro acetate |
|---|---|
| PubChem CID | 24986807 |
| Molecular Formula | C14H30F3N7O8 |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 2-[(4S)-4-amino-5-(2-aminoethylamino)pentyl]-1-nitroguanidine;fluoro acetate |
| SMILES | CC(=O)OF.CC(=O)OF.CC(=O)OF.NCCNC[C@@H](N)CCC/N=C(\N)N[N+](=O)[O-] |
| InChI | InChI=1S/C8H21N7O2.3C2H3FO2/c9-3-5-12-6-7(10)2-1-4-13-8(11)14-15(16)17;3*1-2(4)5-3/h7,12H,1-6,9-10H2,(H3,11,13,14);3*1H3/t7-;;;/m0.../s1 |
| InChIKey | ANQLYQCOJHGGPJ-QTPLPEIMSA-N |
| XLogP | -0.96 |
| TPSA | 236.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|