C16H26F3N7O4 — CID 44570841
2-[(4S)-4-amino-5-[2-(2-aminoethyl)anilino]pentyl]-1-nitroguanidine;2,2,2-trifluoroacetic acid (PubChem CID 44570841) has the molecular formula C16H26F3N7O4 and a molecular weight of 437.42 g/mol. Its IUPAC name is 2-[(4S)-4-amino-5-[2-(2-aminoethyl)anilino]pentyl]-1-nitroguanidine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(4S)-4-amino-5-[2-(2-aminoethyl)anilino]pentyl]-1-nitroguanidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44570841 |
| Molecular Formula | C16H26F3N7O4 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 2-[(4S)-4-amino-5-[2-(2-aminoethyl)anilino]pentyl]-1-nitroguanidine;2,2,2-trifluoroacetic acid |
| SMILES | NCCc1ccccc1NC[C@@H](N)CCC/N=C(\N)N[N+](=O)[O-].O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H25N7O2.C2HF3O2/c15-8-7-11-4-1-2-6-13(11)19-10-12(16)5-3-9-18-14(17)20-21(22)23;3-2(4,5)1(6)7/h1-2,4,6,12,19H,3,5,7-10,15-16H2,(H3,17,18,20);(H,6,7)/t12-;/m0./s1 |
| InChIKey | CRPYPAWSGUQINX-YDALLXLXSA-N |
| XLogP | 0.44 |
| TPSA | 194.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|