C14H23AsN6O2 — CID 87865961
CID 87865961 (PubChem CID 87865961) has the molecular formula C14H23AsN6O2 and a molecular weight of 382.30 g/mol.
| Compound Name | CID 87865961 |
|---|---|
| PubChem CID | 87865961 |
| Molecular Formula | C14H23AsN6O2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | — |
| SMILES | NCCc1ccccc1NC[C@@H]([As])CCC/N=C(\N)N[N+](=O)[O-] |
| InChI | InChI=1S/C14H23AsN6O2/c15-12(5-3-9-18-14(17)20-21(22)23)10-19-13-6-2-1-4-11(13)7-8-16/h1-2,4,6,12,19H,3,5,7-10,16H2,(H3,17,18,20)/t12-/m0/s1 |
| InChIKey | ZIDULOJFLZXSSL-LBPRGKRZSA-N |
| XLogP | 0.43 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|