C15H24N6O4 — CID 11439567
(3S)-3-amino-6-[[amino(nitramido)methylidene]amino]-2-hydroxy-N-(2-phenylethyl)hexanamide (PubChem CID 11439567) has the molecular formula C15H24N6O4 and a molecular weight of 352.40 g/mol. Its IUPAC name is (3S)-3-amino-6-[[amino(nitramido)methylidene]amino]-2-hydroxy-N-(2-phenylethyl)hexanamide.
| Compound Name | (3S)-3-amino-6-[[amino(nitramido)methylidene]amino]-2-hydroxy-N-(2-phenylethyl)hexanamide |
|---|---|
| PubChem CID | 11439567 |
| Molecular Formula | C15H24N6O4 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (3S)-3-amino-6-[[amino(nitramido)methylidene]amino]-2-hydroxy-N-(2-phenylethyl)hexanamide |
| SMILES | N/C(=N\CCC[C@H](N)C(O)C(=O)NCCc1ccccc1)N[N+](=O)[O-] |
| InChI | InChI=1S/C15H24N6O4/c16-12(7-4-9-19-15(17)20-21(24)25)13(22)14(23)18-10-8-11-5-2-1-3-6-11/h1-3,5-6,12-13,22H,4,7-10,16H2,(H,18,23)(H3,17,19,20)/t12-,13?/m0/s1 |
| InChIKey | YVLMYNIWAUONGA-UEWDXFNNSA-N |
| XLogP | -1.09 |
| TPSA | 168.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|