C12H20N6O2 — CID 23523613
2-(4-amino-5-anilinopentyl)-1-nitroguanidine (PubChem CID 23523613) has the molecular formula C12H20N6O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-(4-amino-5-anilinopentyl)-1-nitroguanidine.
| Compound Name | 2-(4-amino-5-anilinopentyl)-1-nitroguanidine |
|---|---|
| PubChem CID | 23523613 |
| Molecular Formula | C12H20N6O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-(4-amino-5-anilinopentyl)-1-nitroguanidine |
| SMILES | N/C(=N\CCCC(N)CNc1ccccc1)N[N+](=O)[O-] |
| InChI | InChI=1S/C12H20N6O2/c13-10(9-16-11-6-2-1-3-7-11)5-4-8-15-12(14)17-18(19)20/h1-3,6-7,10,16H,4-5,8-9,13H2,(H3,14,15,17) |
| InChIKey | RUCORLITKZNQNF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|