C18H34N10O6 — CID 174604855
bis(2-amino-5-(diaminomethylideneamino)pentanoic acid);N-phenylnitramide (PubChem CID 174604855) has the molecular formula C18H34N10O6 and a molecular weight of 486.53 g/mol. Its IUPAC name is bis(2-amino-5-(diaminomethylideneamino)pentanoic acid);N-phenylnitramide.
| Compound Name | bis(2-amino-5-(diaminomethylideneamino)pentanoic acid);N-phenylnitramide |
|---|---|
| PubChem CID | 174604855 |
| Molecular Formula | C18H34N10O6 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | bis(2-amino-5-(diaminomethylideneamino)pentanoic acid);N-phenylnitramide |
| SMILES | NC(N)=NCCCC(N)C(=O)O.NC(N)=NCCCC(N)C(=O)O.O=[N+]([O-])Nc1ccccc1 |
| InChI | InChI=1S/2C6H14N4O2.C6H6N2O2/c2*7-4(5(11)12)2-1-3-10-6(8)9;9-8(10)7-6-4-2-1-3-5-6/h2*4H,1-3,7H2,(H,11,12)(H4,8,9,10);1-5,7H |
| InChIKey | DAMPJVRUKYCBSQ-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 310.61 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|