C9H12N8O4 — CID 18621880
2-[3-[[[amino(nitramido)methylidene]amino]methyl]phenyl]-1-nitroguanidine (PubChem CID 18621880) has the molecular formula C9H12N8O4 and a molecular weight of 296.25 g/mol. Its IUPAC name is 2-[3-[[[amino(nitramido)methylidene]amino]methyl]phenyl]-1-nitroguanidine.
| Compound Name | 2-[3-[[[amino(nitramido)methylidene]amino]methyl]phenyl]-1-nitroguanidine |
|---|---|
| PubChem CID | 18621880 |
| Molecular Formula | C9H12N8O4 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-[3-[[[amino(nitramido)methylidene]amino]methyl]phenyl]-1-nitroguanidine |
| SMILES | N/C(=N\Cc1cccc(/N=C(\N)N[N+](=O)[O-])c1)N[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N8O4/c10-8(14-16(18)19)12-5-6-2-1-3-7(4-6)13-9(11)15-17(20)21/h1-4H,5H2,(H3,10,12,14)(H3,11,13,15) |
| InChIKey | OSGKHYVLBQWWLF-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 187.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|