C4H2F6O3 — CID 57262567
(2,2,2-trifluoro-1-hydroxyethyl) 2,2,2-trifluoroacetate (PubChem CID 57262567) has the molecular formula C4H2F6O3 and a molecular weight of 212.05 g/mol. Its IUPAC name is (2,2,2-trifluoro-1-hydroxyethyl) 2,2,2-trifluoroacetate.
| Compound Name | (2,2,2-trifluoro-1-hydroxyethyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 57262567 |
| Molecular Formula | C4H2F6O3 |
| Molecular Weight | 212.05 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | (2,2,2-trifluoro-1-hydroxyethyl) 2,2,2-trifluoroacetate |
| SMILES | O=C(OC(O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H2F6O3/c5-3(6,7)1(11)13-2(12)4(8,9)10/h1,11H |
| InChIKey | BDEMDDOTQOILDA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.05 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|