About 1-(diethylamino)ethyl 2,2,2-trifluoroacetate
1-(diethylamino)ethyl 2,2,2-trifluoroacetate (PubChem CID 141198748) has the molecular formula C8H14F3NO2
and a molecular weight of 213.20 g/mol. Its IUPAC name is 1-(diethylamino)ethyl 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 1-(diethylamino)ethyl 2,2,2-trifluoroacetate |
| PubChem CID | 141198748 |
| Molecular Formula | C8H14F3NO2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 1-(diethylamino)ethyl 2,2,2-trifluoroacetate |
| SMILES | CCN(CC)C(C)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H14F3NO2/c1-4-12(5-2)6(3)14-7(13)8(9,10)11/h6H,4-5H2,1-3H3 |
| InChIKey | NHDVYTZNGPTKRJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(diethylamino)ethyl 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diethylamino)ethyl 2,2,2-trifluoroacetate?
The IUPAC name of 1-(diethylamino)ethyl 2,2,2-trifluoroacetate (CID 141198748) is 1-(diethylamino)ethyl 2,2,2-trifluoroacetate.
What is the SMILES notation for 1-(diethylamino)ethyl 2,2,2-trifluoroacetate?
The canonical SMILES for 1-(diethylamino)ethyl 2,2,2-trifluoroacetate is CCN(CC)C(C)OC(=O)C(F)(F)F.
What is the InChIKey of 1-(diethylamino)ethyl 2,2,2-trifluoroacetate?
The InChIKey is NHDVYTZNGPTKRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO2/c1-4-12(5-2)6(3)14-7(13)8(9,10)11/h6H,4-5H2,1-3H3.
What are the key properties of 1-(diethylamino)ethyl 2,2,2-trifluoroacetate?
1-(diethylamino)ethyl 2,2,2-trifluoroacetate has a molecular weight of 213.20 g/mol, XLogP of 1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diethylamino)ethyl 2,2,2-trifluoroacetate is sourced from PubChem (CID 141198748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).