About dipropoxymethyl 2,2,2-trifluoroacetate
dipropoxymethyl 2,2,2-trifluoroacetate (PubChem CID 87157146) has the molecular formula C9H15F3O4
and a molecular weight of 244.21 g/mol. Its IUPAC name is dipropoxymethyl 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | dipropoxymethyl 2,2,2-trifluoroacetate |
| PubChem CID | 87157146 |
| Molecular Formula | C9H15F3O4 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | dipropoxymethyl 2,2,2-trifluoroacetate |
| SMILES | CCCOC(OCCC)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H15F3O4/c1-3-5-14-8(15-6-4-2)16-7(13)9(10,11)12/h8H,3-6H2,1-2H3 |
| InChIKey | GEFSRHJCCIOOGO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze dipropoxymethyl 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropoxymethyl 2,2,2-trifluoroacetate?
The IUPAC name of dipropoxymethyl 2,2,2-trifluoroacetate (CID 87157146) is dipropoxymethyl 2,2,2-trifluoroacetate.
What is the SMILES notation for dipropoxymethyl 2,2,2-trifluoroacetate?
The canonical SMILES for dipropoxymethyl 2,2,2-trifluoroacetate is CCCOC(OCCC)OC(=O)C(F)(F)F.
What is the InChIKey of dipropoxymethyl 2,2,2-trifluoroacetate?
The InChIKey is GEFSRHJCCIOOGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3O4/c1-3-5-14-8(15-6-4-2)16-7(13)9(10,11)12/h8H,3-6H2,1-2H3.
What are the key properties of dipropoxymethyl 2,2,2-trifluoroacetate?
dipropoxymethyl 2,2,2-trifluoroacetate has a molecular weight of 244.21 g/mol, XLogP of 2.23, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipropoxymethyl 2,2,2-trifluoroacetate is sourced from PubChem (CID 87157146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).