C3H6N2O7 — CID 22563653
1,2-dinitropropane-1,2,3-triol (PubChem CID 22563653) has the molecular formula C3H6N2O7 and a molecular weight of 182.09 g/mol. Its IUPAC name is 1,2-dinitropropane-1,2,3-triol.
| Compound Name | 1,2-dinitropropane-1,2,3-triol |
|---|---|
| PubChem CID | 22563653 |
| Molecular Formula | C3H6N2O7 |
| Molecular Weight | 182.09 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 1,2-dinitropropane-1,2,3-triol |
| SMILES | O=[N+]([O-])C(O)C(O)(CO)[N+](=O)[O-] |
| InChI | InChI=1S/C3H6N2O7/c6-1-3(8,5(11)12)2(7)4(9)10/h2,6-8H,1H2 |
| InChIKey | ROCADRLEZNOROK-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 146.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.09 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|