C5H11NO4 — CID 88804722
3-methyl-2-nitrobutane-1,3-diol (PubChem CID 88804722) has the molecular formula C5H11NO4 and a molecular weight of 149.15 g/mol. Its IUPAC name is 3-methyl-2-nitrobutane-1,3-diol.
| Compound Name | 3-methyl-2-nitrobutane-1,3-diol |
|---|---|
| PubChem CID | 88804722 |
| Molecular Formula | C5H11NO4 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 3-methyl-2-nitrobutane-1,3-diol |
| SMILES | CC(C)(O)C(CO)[N+](=O)[O-] |
| InChI | InChI=1S/C5H11NO4/c1-5(2,8)4(3-7)6(9)10/h4,7-8H,3H2,1-2H3 |
| InChIKey | VEAZESVBNCVZAY-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|