C5H9N3O6 — CID 154144394
2,2,3-trinitropentane (PubChem CID 154144394) has the molecular formula C5H9N3O6 and a molecular weight of 207.14 g/mol. Its IUPAC name is 2,2,3-trinitropentane.
| Compound Name | 2,2,3-trinitropentane |
|---|---|
| PubChem CID | 154144394 |
| Molecular Formula | C5H9N3O6 |
| Molecular Weight | 207.14 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 2,2,3-trinitropentane |
| SMILES | CCC([N+](=O)[O-])C(C)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C5H9N3O6/c1-3-4(6(9)10)5(2,7(11)12)8(13)14/h4H,3H2,1-2H3 |
| InChIKey | RRODMKRFVZNCPF-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.14 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|