About 1-nitropropan-1-ol;hydrobromide
1-nitropropan-1-ol;hydrobromide (PubChem CID 174552907) has the molecular formula C3H8BrNO3
and a molecular weight of 186.00 g/mol. Its IUPAC name is 1-nitropropan-1-ol;hydrobromide.
Molecular Properties
| Compound Name | 1-nitropropan-1-ol;hydrobromide |
| PubChem CID | 174552907 |
| Molecular Formula | C3H8BrNO3 |
| Molecular Weight | 186.00 g/mol |
| Exact Mass | 184.97 |
| IUPAC Name | 1-nitropropan-1-ol;hydrobromide |
| SMILES | Br.CCC(O)[N+](=O)[O-] |
| InChI | InChI=1S/C3H7NO3.BrH/c1-2-3(5)4(6)7;/h3,5H,2H2,1H3;1H |
| InChIKey | ICAZWOUYGPLMEX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.00 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitropropan-1-ol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitropropan-1-ol;hydrobromide?
The IUPAC name of 1-nitropropan-1-ol;hydrobromide (CID 174552907) is 1-nitropropan-1-ol;hydrobromide.
What is the SMILES notation for 1-nitropropan-1-ol;hydrobromide?
The canonical SMILES for 1-nitropropan-1-ol;hydrobromide is Br.CCC(O)[N+](=O)[O-].
What is the InChIKey of 1-nitropropan-1-ol;hydrobromide?
The InChIKey is ICAZWOUYGPLMEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO3.BrH/c1-2-3(5)4(6)7;/h3,5H,2H2,1H3;1H.
What are the key properties of 1-nitropropan-1-ol;hydrobromide?
1-nitropropan-1-ol;hydrobromide has a molecular weight of 186.00 g/mol, XLogP of 0.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitropropan-1-ol;hydrobromide is sourced from PubChem (CID 174552907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).