About CID 88819167
CID 88819167 (PubChem CID 88819167) has the molecular formula C6H11KNO3
and a molecular weight of 184.26 g/mol.
Molecular Properties
| Compound Name | CID 88819167 |
| PubChem CID | 88819167 |
| Molecular Formula | C6H11KNO3 |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | — |
| SMILES | CCC(=O)C(CC)[N+](=O)[O-].[K] |
| InChI | InChI=1S/C6H11NO3.K/c1-3-5(7(9)10)6(8)4-2;/h5H,3-4H2,1-2H3; |
| InChIKey | QAWQSLBVCINSTN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 88819167 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88819167?
The IUPAC name of CID 88819167 (CID 88819167) is not available.
What is the SMILES notation for CID 88819167?
The canonical SMILES for CID 88819167 is CCC(=O)C(CC)[N+](=O)[O-].[K].
What is the InChIKey of CID 88819167?
The InChIKey is QAWQSLBVCINSTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3.K/c1-3-5(7(9)10)6(8)4-2;/h5H,3-4H2,1-2H3;.
What are the key properties of CID 88819167?
CID 88819167 has a molecular weight of 184.26 g/mol, XLogP of 0.64, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88819167 is sourced from PubChem (CID 88819167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).