About 4-nitrononan-3-one
4-nitrononan-3-one (PubChem CID 13140430) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is 4-nitrononan-3-one.
Molecular Properties
| Compound Name | 4-nitrononan-3-one |
| PubChem CID | 13140430 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 4-nitrononan-3-one |
| SMILES | CCCCCC(C(=O)CC)[N+](=O)[O-] |
| InChI | InChI=1S/C9H17NO3/c1-3-5-6-7-8(10(12)13)9(11)4-2/h8H,3-7H2,1-2H3 |
| InChIKey | JUGBSVYYXMDRLF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrononan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrononan-3-one?
The IUPAC name of 4-nitrononan-3-one (CID 13140430) is 4-nitrononan-3-one.
What is the SMILES notation for 4-nitrononan-3-one?
The canonical SMILES for 4-nitrononan-3-one is CCCCCC(C(=O)CC)[N+](=O)[O-].
What is the InChIKey of 4-nitrononan-3-one?
The InChIKey is JUGBSVYYXMDRLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-3-5-6-7-8(10(12)13)9(11)4-2/h8H,3-7H2,1-2H3.
What are the key properties of 4-nitrononan-3-one?
4-nitrononan-3-one has a molecular weight of 187.24 g/mol, XLogP of 2.19, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrononan-3-one is sourced from PubChem (CID 13140430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).