About barium(2+);hydride;4-nitrodecan-5-one
barium(2+);hydride;4-nitrodecan-5-one (PubChem CID 173462508) has the molecular formula C10H21BaNO3
and a molecular weight of 340.61 g/mol. Its IUPAC name is barium(2+);hydride;4-nitrodecan-5-one.
Molecular Properties
| Compound Name | barium(2+);hydride;4-nitrodecan-5-one |
| PubChem CID | 173462508 |
| Molecular Formula | C10H21BaNO3 |
| Molecular Weight | 340.61 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | barium(2+);hydride;4-nitrodecan-5-one |
| SMILES | CCCCCC(=O)C(CCC)[N+](=O)[O-].[Ba+2].[H-].[H-] |
| InChI | InChI=1S/C10H19NO3.Ba.2H/c1-3-5-6-8-10(12)9(7-4-2)11(13)14;;;/h9H,3-8H2,1-2H3;;;/q;+2;2*-1 |
| InChIKey | SGOGCPOVUSEBMJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.61 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);hydride;4-nitrodecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);hydride;4-nitrodecan-5-one?
The IUPAC name of barium(2+);hydride;4-nitrodecan-5-one (CID 173462508) is barium(2+);hydride;4-nitrodecan-5-one.
What is the SMILES notation for barium(2+);hydride;4-nitrodecan-5-one?
The canonical SMILES for barium(2+);hydride;4-nitrodecan-5-one is CCCCCC(=O)C(CCC)[N+](=O)[O-].[Ba+2].[H-].[H-].
What is the InChIKey of barium(2+);hydride;4-nitrodecan-5-one?
The InChIKey is SGOGCPOVUSEBMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3.Ba.2H/c1-3-5-6-8-10(12)9(7-4-2)11(13)14;;;/h9H,3-8H2,1-2H3;;;/q;+2;2*-1.
What are the key properties of barium(2+);hydride;4-nitrodecan-5-one?
barium(2+);hydride;4-nitrodecan-5-one has a molecular weight of 340.61 g/mol, XLogP of 2.43, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);hydride;4-nitrodecan-5-one is sourced from PubChem (CID 173462508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).