About 2-nitroheptanoic acid
2-nitroheptanoic acid (PubChem CID 22237024) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is 2-nitroheptanoic acid.
Molecular Properties
| Compound Name | 2-nitroheptanoic acid |
| PubChem CID | 22237024 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 2-nitroheptanoic acid |
| SMILES | CCCCCC(C(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C7H13NO4/c1-2-3-4-5-6(7(9)10)8(11)12/h6H,2-5H2,1H3,(H,9,10) |
| InChIKey | SKNSLRFZQRDYJA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroheptanoic acid?
The IUPAC name of 2-nitroheptanoic acid (CID 22237024) is 2-nitroheptanoic acid.
What is the SMILES notation for 2-nitroheptanoic acid?
The canonical SMILES for 2-nitroheptanoic acid is CCCCCC(C(=O)O)[N+](=O)[O-].
What is the InChIKey of 2-nitroheptanoic acid?
The InChIKey is SKNSLRFZQRDYJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4/c1-2-3-4-5-6(7(9)10)8(11)12/h6H,2-5H2,1H3,(H,9,10).
What are the key properties of 2-nitroheptanoic acid?
2-nitroheptanoic acid has a molecular weight of 175.18 g/mol, XLogP of 1.30, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroheptanoic acid is sourced from PubChem (CID 22237024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).