About 10-nitrooctadecan-9-one
10-nitrooctadecan-9-one (PubChem CID 174715744) has the molecular formula C18H35NO3
and a molecular weight of 313.48 g/mol. Its IUPAC name is 10-nitrooctadecan-9-one.
Molecular Properties
| Compound Name | 10-nitrooctadecan-9-one |
| PubChem CID | 174715744 |
| Molecular Formula | C18H35NO3 |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.26 |
| IUPAC Name | 10-nitrooctadecan-9-one |
| SMILES | CCCCCCCCC(=O)C(CCCCCCCC)[N+](=O)[O-] |
| InChI | InChI=1S/C18H35NO3/c1-3-5-7-9-11-13-15-17(19(21)22)18(20)16-14-12-10-8-6-4-2/h17H,3-16H2,1-2H3 |
| InChIKey | IPNXSVAUWKIBDE-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 10-nitrooctadecan-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-nitrooctadecan-9-one?
The IUPAC name of 10-nitrooctadecan-9-one (CID 174715744) is 10-nitrooctadecan-9-one.
What is the SMILES notation for 10-nitrooctadecan-9-one?
The canonical SMILES for 10-nitrooctadecan-9-one is CCCCCCCCC(=O)C(CCCCCCCC)[N+](=O)[O-].
What is the InChIKey of 10-nitrooctadecan-9-one?
The InChIKey is IPNXSVAUWKIBDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35NO3/c1-3-5-7-9-11-13-15-17(19(21)22)18(20)16-14-12-10-8-6-4-2/h17H,3-16H2,1-2H3.
What are the key properties of 10-nitrooctadecan-9-one?
10-nitrooctadecan-9-one has a molecular weight of 313.48 g/mol, XLogP of 5.70, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-nitrooctadecan-9-one is sourced from PubChem (CID 174715744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).