About azanium 5-nitrododecan-4-one
azanium 5-nitrododecan-4-one (PubChem CID 21447408) has the molecular formula C12H27N2O3+
and a molecular weight of 247.36 g/mol. Its IUPAC name is azanium 5-nitrododecan-4-one.
Molecular Properties
| Compound Name | azanium 5-nitrododecan-4-one |
| PubChem CID | 21447408 |
| Molecular Formula | C12H27N2O3+ |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | azanium 5-nitrododecan-4-one |
| SMILES | CCCCCCCC(C(=O)CCC)[N+](=O)[O-].[NH4+] |
| InChI | InChI=1S/C12H23NO3.H3N/c1-3-5-6-7-8-10-11(13(15)16)12(14)9-4-2;/h11H,3-10H2,1-2H3;1H3/p+1 |
| InChIKey | BHGDCEOEILZGRN-UHFFFAOYSA-O |
| XLogP | 3.74 |
| TPSA | 96.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azanium 5-nitrododecan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 5-nitrododecan-4-one?
The IUPAC name of azanium 5-nitrododecan-4-one (CID 21447408) is azanium 5-nitrododecan-4-one.
What is the SMILES notation for azanium 5-nitrododecan-4-one?
The canonical SMILES for azanium 5-nitrododecan-4-one is CCCCCCCC(C(=O)CCC)[N+](=O)[O-].[NH4+].
What is the InChIKey of azanium 5-nitrododecan-4-one?
The InChIKey is BHGDCEOEILZGRN-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H23NO3.H3N/c1-3-5-6-7-8-10-11(13(15)16)12(14)9-4-2;/h11H,3-10H2,1-2H3;1H3/p+1.
What are the key properties of azanium 5-nitrododecan-4-one?
azanium 5-nitrododecan-4-one has a molecular weight of 247.36 g/mol, XLogP of 3.74, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 5-nitrododecan-4-one is sourced from PubChem (CID 21447408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).