About [(2S)-3-methyl-2,3-dinitrobutyl]benzene
[(2S)-3-methyl-2,3-dinitrobutyl]benzene (PubChem CID 139191100) has the molecular formula C11H14N2O4
and a molecular weight of 238.24 g/mol. Its IUPAC name is [(2S)-3-methyl-2,3-dinitrobutyl]benzene.
Molecular Properties
| Compound Name | [(2S)-3-methyl-2,3-dinitrobutyl]benzene |
| PubChem CID | 139191100 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | [(2S)-3-methyl-2,3-dinitrobutyl]benzene |
| SMILES | CC(C)([C@H](Cc1ccccc1)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N2O4/c1-11(2,13(16)17)10(12(14)15)8-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3/t10-/m0/s1 |
| InChIKey | JQLSYZALPVTSRE-JTQLQIEISA-N |
| XLogP | 1.93 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-3-methyl-2,3-dinitrobutyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-3-methyl-2,3-dinitrobutyl]benzene?
The IUPAC name of [(2S)-3-methyl-2,3-dinitrobutyl]benzene (CID 139191100) is [(2S)-3-methyl-2,3-dinitrobutyl]benzene.
What is the SMILES notation for [(2S)-3-methyl-2,3-dinitrobutyl]benzene?
The canonical SMILES for [(2S)-3-methyl-2,3-dinitrobutyl]benzene is CC(C)([C@H](Cc1ccccc1)[N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of [(2S)-3-methyl-2,3-dinitrobutyl]benzene?
The InChIKey is JQLSYZALPVTSRE-JTQLQIEISA-N. The full InChI is InChI=1S/C11H14N2O4/c1-11(2,13(16)17)10(12(14)15)8-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3/t10-/m0/s1.
What are the key properties of [(2S)-3-methyl-2,3-dinitrobutyl]benzene?
[(2S)-3-methyl-2,3-dinitrobutyl]benzene has a molecular weight of 238.24 g/mol, XLogP of 1.93, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-3-methyl-2,3-dinitrobutyl]benzene is sourced from PubChem (CID 139191100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).