About 1,1-dinitroethane;nitromethylbenzene
1,1-dinitroethane;nitromethylbenzene (PubChem CID 88650316) has the molecular formula C9H11N3O6
and a molecular weight of 257.20 g/mol. Its IUPAC name is 1,1-dinitroethane;nitromethylbenzene.
Molecular Properties
| Compound Name | 1,1-dinitroethane;nitromethylbenzene |
| PubChem CID | 88650316 |
| Molecular Formula | C9H11N3O6 |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 1,1-dinitroethane;nitromethylbenzene |
| SMILES | CC([N+](=O)[O-])[N+](=O)[O-].O=[N+]([O-])Cc1ccccc1 |
| InChI | InChI=1S/C7H7NO2.C2H4N2O4/c9-8(10)6-7-4-2-1-3-5-7;1-2(3(5)6)4(7)8/h1-5H,6H2;2H,1H3 |
| InChIKey | CLZXVQJMBPROST-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dinitroethane;nitromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dinitroethane;nitromethylbenzene?
The IUPAC name of 1,1-dinitroethane;nitromethylbenzene (CID 88650316) is 1,1-dinitroethane;nitromethylbenzene.
What is the SMILES notation for 1,1-dinitroethane;nitromethylbenzene?
The canonical SMILES for 1,1-dinitroethane;nitromethylbenzene is CC([N+](=O)[O-])[N+](=O)[O-].O=[N+]([O-])Cc1ccccc1.
What is the InChIKey of 1,1-dinitroethane;nitromethylbenzene?
The InChIKey is CLZXVQJMBPROST-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C2H4N2O4/c9-8(10)6-7-4-2-1-3-5-7;1-2(3(5)6)4(7)8/h1-5H,6H2;2H,1H3.
What are the key properties of 1,1-dinitroethane;nitromethylbenzene?
1,1-dinitroethane;nitromethylbenzene has a molecular weight of 257.20 g/mol, XLogP of 1.35, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dinitroethane;nitromethylbenzene is sourced from PubChem (CID 88650316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).