About methanol;nitromethylbenzene
methanol;nitromethylbenzene (PubChem CID 175133147) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is methanol;nitromethylbenzene.
Molecular Properties
| Compound Name | methanol;nitromethylbenzene |
| PubChem CID | 175133147 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | methanol;nitromethylbenzene |
| SMILES | CO.O=[N+]([O-])Cc1ccccc1 |
| InChI | InChI=1S/C7H7NO2.CH4O/c9-8(10)6-7-4-2-1-3-5-7;1-2/h1-5H,6H2;2H,1H3 |
| InChIKey | VXNUEVQHALGJKT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methanol;nitromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;nitromethylbenzene?
The IUPAC name of methanol;nitromethylbenzene (CID 175133147) is methanol;nitromethylbenzene.
What is the SMILES notation for methanol;nitromethylbenzene?
The canonical SMILES for methanol;nitromethylbenzene is CO.O=[N+]([O-])Cc1ccccc1.
What is the InChIKey of methanol;nitromethylbenzene?
The InChIKey is VXNUEVQHALGJKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.CH4O/c9-8(10)6-7-4-2-1-3-5-7;1-2/h1-5H,6H2;2H,1H3.
What are the key properties of methanol;nitromethylbenzene?
methanol;nitromethylbenzene has a molecular weight of 169.18 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;nitromethylbenzene is sourced from PubChem (CID 175133147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).