C15H17N3O5 — CID 134942360
3-methyl-5-[(2S)-3-methyl-3-nitro-2-phenylbutyl]-4-nitro-1,2-oxazole (PubChem CID 134942360) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 3-methyl-5-[(2S)-3-methyl-3-nitro-2-phenylbutyl]-4-nitro-1,2-oxazole.
| Compound Name | 3-methyl-5-[(2S)-3-methyl-3-nitro-2-phenylbutyl]-4-nitro-1,2-oxazole |
|---|---|
| PubChem CID | 134942360 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3-methyl-5-[(2S)-3-methyl-3-nitro-2-phenylbutyl]-4-nitro-1,2-oxazole |
| SMILES | Cc1noc(C[C@@H](c2ccccc2)C(C)(C)[N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N3O5/c1-10-14(17(19)20)13(23-16-10)9-12(15(2,3)18(21)22)11-7-5-4-6-8-11/h4-8,12H,9H2,1-3H3/t12-/m0/s1 |
| InChIKey | VCXQUWFBBTWWLL-LBPRGKRZSA-N |
| XLogP | 3.27 |
| TPSA | 112.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|