C20H16N4O5 — CID 15984566
5-[2-(1H-indol-3-yl)-2-(4-nitrophenyl)ethyl]-3-methyl-4-nitro-1,2-oxazole (PubChem CID 15984566) has the molecular formula C20H16N4O5 and a molecular weight of 392.37 g/mol. Its IUPAC name is 5-[2-(1H-indol-3-yl)-2-(4-nitrophenyl)ethyl]-3-methyl-4-nitro-1,2-oxazole.
| Compound Name | 5-[2-(1H-indol-3-yl)-2-(4-nitrophenyl)ethyl]-3-methyl-4-nitro-1,2-oxazole |
|---|---|
| PubChem CID | 15984566 |
| Molecular Formula | C20H16N4O5 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 5-[2-(1H-indol-3-yl)-2-(4-nitrophenyl)ethyl]-3-methyl-4-nitro-1,2-oxazole |
| SMILES | Cc1noc(CC(c2ccc([N+](=O)[O-])cc2)c2c[nH]c3ccccc23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16N4O5/c1-12-20(24(27)28)19(29-22-12)10-16(13-6-8-14(9-7-13)23(25)26)17-11-21-18-5-3-2-4-15(17)18/h2-9,11,16,21H,10H2,1H3 |
| InChIKey | XULDZCWJYAPGPH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|