C21H19N3O4 — CID 102157887
5-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-methyl-4-nitro-1,2-oxazole (PubChem CID 102157887) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is 5-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-methyl-4-nitro-1,2-oxazole.
| Compound Name | 5-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-methyl-4-nitro-1,2-oxazole |
|---|---|
| PubChem CID | 102157887 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 5-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-methyl-4-nitro-1,2-oxazole |
| SMILES | COc1ccc(C(Cc2onc(C)c2[N+](=O)[O-])c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C21H19N3O4/c1-13-21(24(25)26)20(28-23-13)11-17(14-7-9-15(27-2)10-8-14)18-12-22-19-6-4-3-5-16(18)19/h3-10,12,17,22H,11H2,1-2H3 |
| InChIKey | DEHWIQCYZSTECW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|