C20H16Cl2N2O4 — CID 11235473
3-(2,4-dichlorophenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)-1-phenylbutan-1-one (PubChem CID 11235473) has the molecular formula C20H16Cl2N2O4 and a molecular weight of 419.26 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)-1-phenylbutan-1-one.
| Compound Name | 3-(2,4-dichlorophenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 11235473 |
| Molecular Formula | C20H16Cl2N2O4 |
| Molecular Weight | 419.26 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)-1-phenylbutan-1-one |
| SMILES | Cc1noc(CC(CC(=O)c2ccccc2)c2ccc(Cl)cc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16Cl2N2O4/c1-12-20(24(26)27)19(28-23-12)10-14(16-8-7-15(21)11-17(16)22)9-18(25)13-5-3-2-4-6-13/h2-8,11,14H,9-10H2,1H3 |
| InChIKey | HLPNLHUGDGLAIW-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.26 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|