C18H14BrClN2O3S — CID 54753368
5-[(2S)-2-(2-bromophenyl)-2-(4-chlorophenyl)sulfanylethyl]-3-methyl-4-nitro-1,2-oxazole (PubChem CID 54753368) has the molecular formula C18H14BrClN2O3S and a molecular weight of 453.75 g/mol. Its IUPAC name is 5-[(2S)-2-(2-bromophenyl)-2-(4-chlorophenyl)sulfanylethyl]-3-methyl-4-nitro-1,2-oxazole.
| Compound Name | 5-[(2S)-2-(2-bromophenyl)-2-(4-chlorophenyl)sulfanylethyl]-3-methyl-4-nitro-1,2-oxazole |
|---|---|
| PubChem CID | 54753368 |
| Molecular Formula | C18H14BrClN2O3S |
| Molecular Weight | 453.75 g/mol |
| Exact Mass | 451.96 |
| IUPAC Name | 5-[(2S)-2-(2-bromophenyl)-2-(4-chlorophenyl)sulfanylethyl]-3-methyl-4-nitro-1,2-oxazole |
| SMILES | Cc1noc(C[C@H](Sc2ccc(Cl)cc2)c2ccccc2Br)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14BrClN2O3S/c1-11-18(22(23)24)16(25-21-11)10-17(14-4-2-3-5-15(14)19)26-13-8-6-12(20)7-9-13/h2-9,17H,10H2,1H3/t17-/m0/s1 |
| InChIKey | QFJFTVRXYOAJLA-KRWDZBQOSA-N |
| XLogP | 6.38 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.75 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|