C13H13BrN2O3 — CID 102222358
4-[(1R)-1-(2-bromophenyl)-2-nitroethyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 102222358) has the molecular formula C13H13BrN2O3 and a molecular weight of 325.16 g/mol. Its IUPAC name is 4-[(1R)-1-(2-bromophenyl)-2-nitroethyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[(1R)-1-(2-bromophenyl)-2-nitroethyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 102222358 |
| Molecular Formula | C13H13BrN2O3 |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 4-[(1R)-1-(2-bromophenyl)-2-nitroethyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1[C@@H](C[N+](=O)[O-])c1ccccc1Br |
| InChI | InChI=1S/C13H13BrN2O3/c1-8-13(9(2)19-15-8)11(7-16(17)18)10-5-3-4-6-12(10)14/h3-6,11H,7H2,1-2H3/t11-/m0/s1 |
| InChIKey | BDKUKCNPVLNNSC-NSHDSACASA-N |
| XLogP | 3.46 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|