C19H20BrNO3 — CID 102159950
(E,2R)-2-[(1S)-1-(2-bromophenyl)-2-nitroethyl]-4-phenylpent-3-en-1-ol (PubChem CID 102159950) has the molecular formula C19H20BrNO3 and a molecular weight of 390.28 g/mol. Its IUPAC name is (E,2R)-2-[(1S)-1-(2-bromophenyl)-2-nitroethyl]-4-phenylpent-3-en-1-ol.
| Compound Name | (E,2R)-2-[(1S)-1-(2-bromophenyl)-2-nitroethyl]-4-phenylpent-3-en-1-ol |
|---|---|
| PubChem CID | 102159950 |
| Molecular Formula | C19H20BrNO3 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | (E,2R)-2-[(1S)-1-(2-bromophenyl)-2-nitroethyl]-4-phenylpent-3-en-1-ol |
| SMILES | C/C(=C\[C@@H](CO)[C@H](C[N+](=O)[O-])c1ccccc1Br)c1ccccc1 |
| InChI | InChI=1S/C19H20BrNO3/c1-14(15-7-3-2-4-8-15)11-16(13-22)18(12-21(23)24)17-9-5-6-10-19(17)20/h2-11,16,18,22H,12-13H2,1H3/b14-11+/t16-,18-/m0/s1 |
| InChIKey | MOTPXZXQECSRDO-SPRNKHAWSA-N |
| XLogP | 4.52 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|