C12H14BrNO3 — CID 75237476
3-(2-bromophenyl)-2,2-dimethyl-4-nitrobutanal (PubChem CID 75237476) has the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. Its IUPAC name is 3-(2-bromophenyl)-2,2-dimethyl-4-nitrobutanal.
| Compound Name | 3-(2-bromophenyl)-2,2-dimethyl-4-nitrobutanal |
|---|---|
| PubChem CID | 75237476 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 3-(2-bromophenyl)-2,2-dimethyl-4-nitrobutanal |
| SMILES | CC(C)(C=O)C(C[N+](=O)[O-])c1ccccc1Br |
| InChI | InChI=1S/C12H14BrNO3/c1-12(2,8-15)10(7-14(16)17)9-5-3-4-6-11(9)13/h3-6,8,10H,7H2,1-2H3 |
| InChIKey | IWFHGLRCCCKBST-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|