C12H14N2O5 — CID 125477130
(3S)-2,2-dimethyl-4-nitro-3-(2-nitrophenyl)butanal (PubChem CID 125477130) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is (3S)-2,2-dimethyl-4-nitro-3-(2-nitrophenyl)butanal.
| Compound Name | (3S)-2,2-dimethyl-4-nitro-3-(2-nitrophenyl)butanal |
|---|---|
| PubChem CID | 125477130 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (3S)-2,2-dimethyl-4-nitro-3-(2-nitrophenyl)butanal |
| SMILES | CC(C)(C=O)[C@@H](C[N+](=O)[O-])c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N2O5/c1-12(2,8-15)10(7-13(16)17)9-5-3-4-6-11(9)14(18)19/h3-6,8,10H,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | LEKAJNMCKGVSMS-JTQLQIEISA-N |
| XLogP | 2.18 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|