C18H19ClN2O6 — CID 11610913
ethyl 2-acetyl-3-(2-chlorophenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)butanoate (PubChem CID 11610913) has the molecular formula C18H19ClN2O6 and a molecular weight of 394.81 g/mol. Its IUPAC name is ethyl 2-acetyl-3-(2-chlorophenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)butanoate.
| Compound Name | ethyl 2-acetyl-3-(2-chlorophenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)butanoate |
|---|---|
| PubChem CID | 11610913 |
| Molecular Formula | C18H19ClN2O6 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | ethyl 2-acetyl-3-(2-chlorophenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)butanoate |
| SMILES | CCOC(=O)C(C(C)=O)C(Cc1onc(C)c1[N+](=O)[O-])c1ccccc1Cl |
| InChI | InChI=1S/C18H19ClN2O6/c1-4-26-18(23)16(11(3)22)13(12-7-5-6-8-14(12)19)9-15-17(21(24)25)10(2)20-27-15/h5-8,13,16H,4,9H2,1-3H3 |
| InChIKey | WJNBOALTUXMATL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 112.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|