C13H22N+ — CID 140963970
[(2S)-4,4-dimethyl-1-phenylpentan-2-yl]azanium (PubChem CID 140963970) has the molecular formula C13H22N+ and a molecular weight of 192.33 g/mol. Its IUPAC name is [(2S)-4,4-dimethyl-1-phenylpentan-2-yl]azanium.
| Compound Name | [(2S)-4,4-dimethyl-1-phenylpentan-2-yl]azanium |
|---|---|
| PubChem CID | 140963970 |
| Molecular Formula | C13H22N+ |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.17 |
| IUPAC Name | [(2S)-4,4-dimethyl-1-phenylpentan-2-yl]azanium |
| SMILES | CC(C)(C)C[C@H]([NH3+])Cc1ccccc1 |
| InChI | InChI=1S/C13H21N/c1-13(2,3)10-12(14)9-11-7-5-4-6-8-11/h4-8,12H,9-10,14H2,1-3H3/p+1/t12-/m1/s1 |
| InChIKey | PXYQDVJNLDUHAB-GFCCVEGCSA-O |
| XLogP | 2.28 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |