C16H27P — CID 138738585
methyl-(3,5,5-trimethyl-1-phenylhexan-2-yl)phosphane (PubChem CID 138738585) has the molecular formula C16H27P and a molecular weight of 250.37 g/mol. Its IUPAC name is methyl-(3,5,5-trimethyl-1-phenylhexan-2-yl)phosphane.
| Compound Name | methyl-(3,5,5-trimethyl-1-phenylhexan-2-yl)phosphane |
|---|---|
| PubChem CID | 138738585 |
| Molecular Formula | C16H27P |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | methyl-(3,5,5-trimethyl-1-phenylhexan-2-yl)phosphane |
| SMILES | CPC(Cc1ccccc1)C(C)CC(C)(C)C |
| InChI | InChI=1S/C16H27P/c1-13(12-16(2,3)4)15(17-5)11-14-9-7-6-8-10-14/h6-10,13,15,17H,11-12H2,1-5H3 |
| InChIKey | CKFQQMXYFFOJQN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|