C13H19Br — CID 79298231
(3-bromo-2,4-dimethylpentyl)benzene (PubChem CID 79298231) has the molecular formula C13H19Br and a molecular weight of 255.20 g/mol. Its IUPAC name is (3-bromo-2,4-dimethylpentyl)benzene.
| Compound Name | (3-bromo-2,4-dimethylpentyl)benzene |
|---|---|
| PubChem CID | 79298231 |
| Molecular Formula | C13H19Br |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (3-bromo-2,4-dimethylpentyl)benzene |
| SMILES | CC(C)C(Br)C(C)Cc1ccccc1 |
| InChI | InChI=1S/C13H19Br/c1-10(2)13(14)11(3)9-12-7-5-4-6-8-12/h4-8,10-11,13H,9H2,1-3H3 |
| InChIKey | YCPUQGFSLMYMQS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|