2,4,5-trihydroxy-2-methylpentanoic acid

C6H12O5 — CID 87080116

IUPAC2,4,5-trihydroxy-2-methylpentanoic acid
SMILESCC(O)(CC(O)CO)C(=O)O
InChIInChI=1S/C6H12O5/c1-6(11,5(9)10)2-4(8)3-7/h4,7-8,11H,2-3H2,1H3,(H,9,10)
InChIKeyRFSDMKGKXCVVLT-UHFFFAOYSA-N
MW164.16 g/mol
LogP-1.43
Rot. Bonds4

About 2,4,5-trihydroxy-2-methylpentanoic acid

2,4,5-trihydroxy-2-methylpentanoic acid (PubChem CID 87080116) has the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. Its IUPAC name is 2,4,5-trihydroxy-2-methylpentanoic acid.

Molecular Properties

Compound Name2,4,5-trihydroxy-2-methylpentanoic acid
PubChem CID87080116
Molecular FormulaC6H12O5
Molecular Weight164.16 g/mol
Exact Mass164.07
IUPAC Name2,4,5-trihydroxy-2-methylpentanoic acid
SMILESCC(O)(CC(O)CO)C(=O)O
InChIInChI=1S/C6H12O5/c1-6(11,5(9)10)2-4(8)3-7/h4,7-8,11H,2-3H2,1H3,(H,9,10)
InChIKeyRFSDMKGKXCVVLT-UHFFFAOYSA-N
XLogP-1.43
TPSA97.99 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.16
LogP ≤ 5-1.43
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2,4,5-trihydroxy-2-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4,5-trihydroxy-2-methylpentanoic acid?
The IUPAC name of 2,4,5-trihydroxy-2-methylpentanoic acid (CID 87080116) is 2,4,5-trihydroxy-2-methylpentanoic acid.
What is the SMILES notation for 2,4,5-trihydroxy-2-methylpentanoic acid?
The canonical SMILES for 2,4,5-trihydroxy-2-methylpentanoic acid is CC(O)(CC(O)CO)C(=O)O.
What is the InChIKey of 2,4,5-trihydroxy-2-methylpentanoic acid?
The InChIKey is RFSDMKGKXCVVLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O5/c1-6(11,5(9)10)2-4(8)3-7/h4,7-8,11H,2-3H2,1H3,(H,9,10).
What are the key properties of 2,4,5-trihydroxy-2-methylpentanoic acid?
2,4,5-trihydroxy-2-methylpentanoic acid has a molecular weight of 164.16 g/mol, XLogP of -1.43, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-trihydroxy-2-methylpentanoic acid is sourced from PubChem (CID 87080116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).