C12H24O4 — CID 174827470
4,4-dimethylpentane-1,2-diol;2-methylbut-2-enoic acid (PubChem CID 174827470) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is 4,4-dimethylpentane-1,2-diol;2-methylbut-2-enoic acid.
| Compound Name | 4,4-dimethylpentane-1,2-diol;2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 174827470 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 4,4-dimethylpentane-1,2-diol;2-methylbut-2-enoic acid |
| SMILES | CC(C)(C)CC(O)CO.CC=C(C)C(=O)O |
| InChI | InChI=1S/C7H16O2.C5H8O2/c1-7(2,3)4-6(9)5-8;1-3-4(2)5(6)7/h6,8-9H,4-5H2,1-3H3;3H,1-2H3,(H,6,7) |
| InChIKey | MCTOUKILFNOPTG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|