C9H18O9Zn — CID 158465195
zinc;bis(2-hydroxypropanoate);propane-1,2,3-triol (PubChem CID 158465195) has the molecular formula C9H18O9Zn and a molecular weight of 335.62 g/mol. Its IUPAC name is zinc;bis(2-hydroxypropanoate);propane-1,2,3-triol.
| Compound Name | zinc;bis(2-hydroxypropanoate);propane-1,2,3-triol |
|---|---|
| PubChem CID | 158465195 |
| Molecular Formula | C9H18O9Zn |
| Molecular Weight | 335.62 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | zinc;bis(2-hydroxypropanoate);propane-1,2,3-triol |
| SMILES | CC(O)C(=O)[O-].CC(O)C(=O)[O-].OCC(O)CO.[Zn+2] |
| InChI | InChI=1S/C3H8O3.2C3H6O3.Zn/c4-1-3(6)2-5;2*1-2(4)3(5)6;/h3-6H,1-2H2;2*2,4H,1H3,(H,5,6);/q;;;+2/p-2 |
| InChIKey | HFQYMQBXMQICSZ-UHFFFAOYSA-L |
| XLogP | -5.44 |
| TPSA | 181.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.62 |
| LogP ≤ 5 | -5.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|