About propane-1,2-diol;yttrium(3+);trinitrate
propane-1,2-diol;yttrium(3+);trinitrate (PubChem CID 172735884) has the molecular formula C3H8N3O11Y
and a molecular weight of 351.01 g/mol. Its IUPAC name is propane-1,2-diol;yttrium(3+);trinitrate.
Molecular Properties
| Compound Name | propane-1,2-diol;yttrium(3+);trinitrate |
| PubChem CID | 172735884 |
| Molecular Formula | C3H8N3O11Y |
| Molecular Weight | 351.01 g/mol |
| Exact Mass | 350.92 |
| IUPAC Name | propane-1,2-diol;yttrium(3+);trinitrate |
| SMILES | CC(O)CO.O=[N+]([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Y+3] |
| InChI | InChI=1S/C3H8O2.3NO3.Y/c1-3(5)2-4;3*2-1(3)4;/h3-5H,2H2,1H3;;;;/q;3*-1;+3 |
| InChIKey | IKUMCWPZAPOUDW-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 239.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.01 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propane-1,2-diol;yttrium(3+);trinitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-1,2-diol;yttrium(3+);trinitrate?
The IUPAC name of propane-1,2-diol;yttrium(3+);trinitrate (CID 172735884) is propane-1,2-diol;yttrium(3+);trinitrate.
What is the SMILES notation for propane-1,2-diol;yttrium(3+);trinitrate?
The canonical SMILES for propane-1,2-diol;yttrium(3+);trinitrate is CC(O)CO.O=[N+]([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Y+3].
What is the InChIKey of propane-1,2-diol;yttrium(3+);trinitrate?
The InChIKey is IKUMCWPZAPOUDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.3NO3.Y/c1-3(5)2-4;3*2-1(3)4;/h3-5H,2H2,1H3;;;;/q;3*-1;+3.
What are the key properties of propane-1,2-diol;yttrium(3+);trinitrate?
propane-1,2-diol;yttrium(3+);trinitrate has a molecular weight of 351.01 g/mol, XLogP of -1.36, 1 rotatable bonds, 2 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for propane-1,2-diol;yttrium(3+);trinitrate is sourced from PubChem (CID 172735884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).