About ozone;propane-1,2-diol
ozone;propane-1,2-diol (PubChem CID 161263116) has the molecular formula C3H8O5
and a molecular weight of 124.09 g/mol. Its IUPAC name is ozone;propane-1,2-diol.
Molecular Properties
| Compound Name | ozone;propane-1,2-diol |
| PubChem CID | 161263116 |
| Molecular Formula | C3H8O5 |
| Molecular Weight | 124.09 g/mol |
| Exact Mass | 124.04 |
| IUPAC Name | ozone;propane-1,2-diol |
| SMILES | CC(O)CO.O=[O+][O-] |
| InChI | InChI=1S/C3H8O2.O3/c1-3(5)2-4;1-3-2/h3-5H,2H2,1H3; |
| InChIKey | VCUZNJLJLUJUOK-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 91.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.09 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ozone;propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ozone;propane-1,2-diol?
The IUPAC name of ozone;propane-1,2-diol (CID 161263116) is ozone;propane-1,2-diol.
What is the SMILES notation for ozone;propane-1,2-diol?
The canonical SMILES for ozone;propane-1,2-diol is CC(O)CO.O=[O+][O-].
What is the InChIKey of ozone;propane-1,2-diol?
The InChIKey is VCUZNJLJLUJUOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.O3/c1-3(5)2-4;1-3-2/h3-5H,2H2,1H3;.
What are the key properties of ozone;propane-1,2-diol?
ozone;propane-1,2-diol has a molecular weight of 124.09 g/mol, XLogP of -1.76, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ozone;propane-1,2-diol is sourced from PubChem (CID 161263116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).