C3H8NNaO4 — CID 158616438
sodium;propane-1,2-diol;nitrite (PubChem CID 158616438) has the molecular formula C3H8NNaO4 and a molecular weight of 145.09 g/mol. Its IUPAC name is sodium;propane-1,2-diol;nitrite.
| Compound Name | sodium;propane-1,2-diol;nitrite |
|---|---|
| PubChem CID | 158616438 |
| Molecular Formula | C3H8NNaO4 |
| Molecular Weight | 145.09 g/mol |
| Exact Mass | 145.04 |
| IUPAC Name | sodium;propane-1,2-diol;nitrite |
| SMILES | CC(O)CO.O=N[O-].[Na+] |
| InChI | InChI=1S/C3H8O2.HNO2.Na/c1-3(5)2-4;2-1-3;/h3-5H,2H2,1H3;(H,2,3);/q;;+1/p-1 |
| InChIKey | HXLIFSLBEBNLJI-UHFFFAOYSA-M |
| XLogP | -3.39 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.09 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|